About 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine
5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine (PubChem CID 82192018) has the molecular formula C11H11Cl2N3S
and a molecular weight of 288.20 g/mol. Its IUPAC name is 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine |
| PubChem CID | 82192018 |
| Molecular Formula | C11H11Cl2N3S |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine |
| SMILES | Clc1cc(Cl)c2sc(NC3CCNC3)nc2c1 |
| InChI | InChI=1S/C11H11Cl2N3S/c12-6-3-8(13)10-9(4-6)16-11(17-10)15-7-1-2-14-5-7/h3-4,7,14H,1-2,5H2,(H,15,16) |
| InChIKey | NZYKQEFSILCSHN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine?
The IUPAC name of 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine (CID 82192018) is 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine.
What is the SMILES notation for 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine?
The canonical SMILES for 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine is Clc1cc(Cl)c2sc(NC3CCNC3)nc2c1.
What is the InChIKey of 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine?
The InChIKey is NZYKQEFSILCSHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N3S/c12-6-3-8(13)10-9(4-6)16-11(17-10)15-7-1-2-14-5-7/h3-4,7,14H,1-2,5H2,(H,15,16).
What are the key properties of 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine?
5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine has a molecular weight of 288.20 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-N-pyrrolidin-3-yl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 82192018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).