About 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine
1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine (PubChem CID 82192144) has the molecular formula C16H18N6
and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine |
| PubChem CID | 82192144 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine |
| SMILES | NC1CCN(c2ncnc3c2cnn3-c2ccccc2)CC1 |
| InChI | InChI=1S/C16H18N6/c17-12-6-8-21(9-7-12)15-14-10-20-22(16(14)19-11-18-15)13-4-2-1-3-5-13/h1-5,10-12H,6-9,17H2 |
| InChIKey | IFJHQQQIAYIKQW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine?
The IUPAC name of 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine (CID 82192144) is 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine.
What is the SMILES notation for 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine?
The canonical SMILES for 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine is NC1CCN(c2ncnc3c2cnn3-c2ccccc2)CC1.
What is the InChIKey of 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine?
The InChIKey is IFJHQQQIAYIKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6/c17-12-6-8-21(9-7-12)15-14-10-20-22(16(14)19-11-18-15)13-4-2-1-3-5-13/h1-5,10-12H,6-9,17H2.
What are the key properties of 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine?
1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine has a molecular weight of 294.36 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-amine is sourced from PubChem (CID 82192144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).