About [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine
[4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine (PubChem CID 82192474) has the molecular formula C8H9F3N4
and a molecular weight of 218.18 g/mol. Its IUPAC name is [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine |
| PubChem CID | 82192474 |
| Molecular Formula | C8H9F3N4 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc2c(c(C(F)(F)F)n1)CCC2 |
| InChI | InChI=1S/C8H9F3N4/c9-8(10,11)6-4-2-1-3-5(4)13-7(14-6)15-12/h1-3,12H2,(H,13,14,15) |
| InChIKey | JTVSLAXUKVBFRL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine?
The IUPAC name of [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine (CID 82192474) is [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine.
What is the SMILES notation for [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine?
The canonical SMILES for [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine is NNc1nc2c(c(C(F)(F)F)n1)CCC2.
What is the InChIKey of [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine?
The InChIKey is JTVSLAXUKVBFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N4/c9-8(10,11)6-4-2-1-3-5(4)13-7(14-6)15-12/h1-3,12H2,(H,13,14,15).
What are the key properties of [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine?
[4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine has a molecular weight of 218.18 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl]hydrazine is sourced from PubChem (CID 82192474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).