C11H9ClN6 — CID 82192496
[1-(2-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 82192496) has the molecular formula C11H9ClN6 and a molecular weight of 260.69 g/mol. Its IUPAC name is [1-(2-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [1-(2-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82192496 |
| Molecular Formula | C11H9ClN6 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | [1-(2-chlorophenyl)pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1ncnc2c1cnn2-c1ccccc1Cl |
| InChI | InChI=1S/C11H9ClN6/c12-8-3-1-2-4-9(8)18-11-7(5-16-18)10(17-13)14-6-15-11/h1-6H,13H2,(H,14,15,17) |
| InChIKey | RWSOIGCVUFAOST-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|