C13H16F3N3O2 — CID 82192990
4-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]butanoic acid (PubChem CID 82192990) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 82192990 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-[[4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazolin-2-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc2c(c(C(F)(F)F)n1)CCCC2 |
| InChI | InChI=1S/C13H16F3N3O2/c14-13(15,16)11-8-4-1-2-5-9(8)18-12(19-11)17-7-3-6-10(20)21/h1-7H2,(H,20,21)(H,17,18,19) |
| InChIKey | RJBBHOZWSSMBJH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|