C16H24N2O4 — CID 82193192
4-amino-5-(3,4-dimethoxyphenyl)-1-(3-methoxypropyl)pyrrolidin-2-one (PubChem CID 82193192) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-amino-5-(3,4-dimethoxyphenyl)-1-(3-methoxypropyl)pyrrolidin-2-one.
| Compound Name | 4-amino-5-(3,4-dimethoxyphenyl)-1-(3-methoxypropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 82193192 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-amino-5-(3,4-dimethoxyphenyl)-1-(3-methoxypropyl)pyrrolidin-2-one |
| SMILES | COCCCN1C(=O)CC(N)C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O4/c1-20-8-4-7-18-15(19)10-12(17)16(18)11-5-6-13(21-2)14(9-11)22-3/h5-6,9,12,16H,4,7-8,10,17H2,1-3H3 |
| InChIKey | KATCSZGPERDIRK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|