C12H11Cl2N3O2 — CID 82195620
3-[1-(3,4-dichlorophenyl)-5-methyltriazol-4-yl]propanoic acid (PubChem CID 82195620) has the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.15 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)-5-methyltriazol-4-yl]propanoic acid.
| Compound Name | 3-[1-(3,4-dichlorophenyl)-5-methyltriazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 82195620 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)-5-methyltriazol-4-yl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)nnn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O2/c1-7-11(4-5-12(18)19)15-16-17(7)8-2-3-9(13)10(14)6-8/h2-3,6H,4-5H2,1H3,(H,18,19) |
| InChIKey | JFZGJEQNFNXCGS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |