About 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile
5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile (PubChem CID 82195795) has the molecular formula C15H18N4
and a molecular weight of 254.34 g/mol. Its IUPAC name is 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile |
| PubChem CID | 82195795 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile |
| SMILES | Cc1ccc(C)c(-n2nnc(C#N)c2C(C)(C)C)c1 |
| InChI | InChI=1S/C15H18N4/c1-10-6-7-11(2)13(8-10)19-14(15(3,4)5)12(9-16)17-18-19/h6-8H,1-5H3 |
| InChIKey | AHJVBWAYPUZTHL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile?
The IUPAC name of 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile (CID 82195795) is 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile.
What is the SMILES notation for 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile?
The canonical SMILES for 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile is Cc1ccc(C)c(-n2nnc(C#N)c2C(C)(C)C)c1.
What is the InChIKey of 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile?
The InChIKey is AHJVBWAYPUZTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4/c1-10-6-7-11(2)13(8-10)19-14(15(3,4)5)12(9-16)17-18-19/h6-8H,1-5H3.
What are the key properties of 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile?
5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile has a molecular weight of 254.34 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1-(2,5-dimethylphenyl)triazole-4-carbonitrile is sourced from PubChem (CID 82195795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).