C14H15ClN4 — CID 82196308
1-(5-chloro-2-methylphenyl)-5-(2-methylpropyl)triazole-4-carbonitrile (PubChem CID 82196308) has the molecular formula C14H15ClN4 and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-5-(2-methylpropyl)triazole-4-carbonitrile.
| Compound Name | 1-(5-chloro-2-methylphenyl)-5-(2-methylpropyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 82196308 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-5-(2-methylpropyl)triazole-4-carbonitrile |
| SMILES | Cc1ccc(Cl)cc1-n1nnc(C#N)c1CC(C)C |
| InChI | InChI=1S/C14H15ClN4/c1-9(2)6-14-12(8-16)17-18-19(14)13-7-11(15)5-4-10(13)3/h4-5,7,9H,6H2,1-3H3 |
| InChIKey | FHURJEUJSIKTST-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |