C17H15N3O2 — CID 82198087
2-[1-(3-methylphenyl)-5-phenyltriazol-4-yl]acetic acid (PubChem CID 82198087) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[1-(3-methylphenyl)-5-phenyltriazol-4-yl]acetic acid.
| Compound Name | 2-[1-(3-methylphenyl)-5-phenyltriazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 82198087 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[1-(3-methylphenyl)-5-phenyltriazol-4-yl]acetic acid |
| SMILES | Cc1cccc(-n2nnc(CC(=O)O)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C17H15N3O2/c1-12-6-5-9-14(10-12)20-17(13-7-3-2-4-8-13)15(18-19-20)11-16(21)22/h2-10H,11H2,1H3,(H,21,22) |
| InChIKey | YPDLKINIOMYZEH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |