C17H16FN3O — CID 82198742
[1-(3,5-dimethylphenyl)-5-(3-fluorophenyl)triazol-4-yl]methanol (PubChem CID 82198742) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is [1-(3,5-dimethylphenyl)-5-(3-fluorophenyl)triazol-4-yl]methanol.
| Compound Name | [1-(3,5-dimethylphenyl)-5-(3-fluorophenyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 82198742 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [1-(3,5-dimethylphenyl)-5-(3-fluorophenyl)triazol-4-yl]methanol |
| SMILES | Cc1cc(C)cc(-n2nnc(CO)c2-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H16FN3O/c1-11-6-12(2)8-15(7-11)21-17(16(10-22)19-20-21)13-4-3-5-14(18)9-13/h3-9,22H,10H2,1-2H3 |
| InChIKey | JBMKAKAWDXKZPT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |