C19H20N4 — CID 82199235
[1-(4-methylphenyl)-5-[(E)-2-(4-methylphenyl)ethenyl]triazol-4-yl]methanamine (PubChem CID 82199235) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is [1-(4-methylphenyl)-5-[(E)-2-(4-methylphenyl)ethenyl]triazol-4-yl]methanamine.
| Compound Name | [1-(4-methylphenyl)-5-[(E)-2-(4-methylphenyl)ethenyl]triazol-4-yl]methanamine |
|---|---|
| PubChem CID | 82199235 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [1-(4-methylphenyl)-5-[(E)-2-(4-methylphenyl)ethenyl]triazol-4-yl]methanamine |
| SMILES | Cc1ccc(/C=C/c2c(CN)nnn2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H20N4/c1-14-3-7-16(8-4-14)9-12-19-18(13-20)21-22-23(19)17-10-5-15(2)6-11-17/h3-12H,13,20H2,1-2H3/b12-9+ |
| InChIKey | AXYDTFZIWIDFME-FMIVXFBMSA-N |
| XLogP | 3.51 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |