C14H15N3O5 — CID 82201048
5-butyl-1-(3-carboxy-4-hydroxyphenyl)triazole-4-carboxylic acid (PubChem CID 82201048) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 5-butyl-1-(3-carboxy-4-hydroxyphenyl)triazole-4-carboxylic acid.
| Compound Name | 5-butyl-1-(3-carboxy-4-hydroxyphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82201048 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 5-butyl-1-(3-carboxy-4-hydroxyphenyl)triazole-4-carboxylic acid |
| SMILES | CCCCc1c(C(=O)O)nnn1-c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H15N3O5/c1-2-3-4-10-12(14(21)22)15-16-17(10)8-5-6-11(18)9(7-8)13(19)20/h5-7,18H,2-4H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | KPLDJBQNVKSKOM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |