C13H8FN3O2S — CID 82201260
1-(3-fluorophenyl)-5-thiophen-2-yltriazole-4-carboxylic acid (PubChem CID 82201260) has the molecular formula C13H8FN3O2S and a molecular weight of 289.29 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-5-thiophen-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-(3-fluorophenyl)-5-thiophen-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82201260 |
| Molecular Formula | C13H8FN3O2S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-(3-fluorophenyl)-5-thiophen-2-yltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(-c2cccc(F)c2)c1-c1cccs1 |
| InChI | InChI=1S/C13H8FN3O2S/c14-8-3-1-4-9(7-8)17-12(10-5-2-6-20-10)11(13(18)19)15-16-17/h1-7H,(H,18,19) |
| InChIKey | LZXDYRJXJAWOCK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |