C15H20N4O3 — CID 82201327
1-[4-(diethylamino)phenyl]-5-(methoxymethyl)triazole-4-carboxylic acid (PubChem CID 82201327) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-5-(methoxymethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[4-(diethylamino)phenyl]-5-(methoxymethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82201327 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-5-(methoxymethyl)triazole-4-carboxylic acid |
| SMILES | CCN(CC)c1ccc(-n2nnc(C(=O)O)c2COC)cc1 |
| InChI | InChI=1S/C15H20N4O3/c1-4-18(5-2)11-6-8-12(9-7-11)19-13(10-22-3)14(15(20)21)16-17-19/h6-9H,4-5,10H2,1-3H3,(H,20,21) |
| InChIKey | MPVRKFGBOPPCIQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|