C17H20N4O — CID 82204244
5-(oxolan-2-yl)-1-[(4-propan-2-ylphenyl)methyl]triazole-4-carbonitrile (PubChem CID 82204244) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 5-(oxolan-2-yl)-1-[(4-propan-2-ylphenyl)methyl]triazole-4-carbonitrile.
| Compound Name | 5-(oxolan-2-yl)-1-[(4-propan-2-ylphenyl)methyl]triazole-4-carbonitrile |
|---|---|
| PubChem CID | 82204244 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-(oxolan-2-yl)-1-[(4-propan-2-ylphenyl)methyl]triazole-4-carbonitrile |
| SMILES | CC(C)c1ccc(Cn2nnc(C#N)c2C2CCCO2)cc1 |
| InChI | InChI=1S/C17H20N4O/c1-12(2)14-7-5-13(6-8-14)11-21-17(15(10-18)19-20-21)16-4-3-9-22-16/h5-8,12,16H,3-4,9,11H2,1-2H3 |
| InChIKey | QXNXPHVTFDFHFG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |