About [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine
[5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine (PubChem CID 82205870) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine |
| PubChem CID | 82205870 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine |
| SMILES | CCCCCn1nnc(CN)c1COc1c(C)cccc1C |
| InChI | InChI=1S/C17H26N4O/c1-4-5-6-10-21-16(15(11-18)19-20-21)12-22-17-13(2)8-7-9-14(17)3/h7-9H,4-6,10-12,18H2,1-3H3 |
| InChIKey | DNPAVVJAEKLLQG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine?
The IUPAC name of [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine (CID 82205870) is [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine.
What is the SMILES notation for [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine?
The canonical SMILES for [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine is CCCCCn1nnc(CN)c1COc1c(C)cccc1C.
What is the InChIKey of [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine?
The InChIKey is DNPAVVJAEKLLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O/c1-4-5-6-10-21-16(15(11-18)19-20-21)12-22-17-13(2)8-7-9-14(17)3/h7-9H,4-6,10-12,18H2,1-3H3.
What are the key properties of [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine?
[5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine has a molecular weight of 302.42 g/mol, XLogP of 3.12, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,6-dimethylphenoxy)methyl]-1-pentyltriazol-4-yl]methanamine is sourced from PubChem (CID 82205870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).