C12H13N5 — CID 82206639
2-[4-(aminomethyl)-5-(3-methylphenyl)triazol-1-yl]acetonitrile (PubChem CID 82206639) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-5-(3-methylphenyl)triazol-1-yl]acetonitrile.
| Compound Name | 2-[4-(aminomethyl)-5-(3-methylphenyl)triazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 82206639 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[4-(aminomethyl)-5-(3-methylphenyl)triazol-1-yl]acetonitrile |
| SMILES | Cc1cccc(-c2c(CN)nnn2CC#N)c1 |
| InChI | InChI=1S/C12H13N5/c1-9-3-2-4-10(7-9)12-11(8-14)15-16-17(12)6-5-13/h2-4,7H,6,8,14H2,1H3 |
| InChIKey | BFNDFIJFUORAJM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |