C11H11Cl2N3O2 — CID 82207746
[5-[(2,4-dichlorophenoxy)methyl]-1-methyltriazol-4-yl]methanol (PubChem CID 82207746) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is [5-[(2,4-dichlorophenoxy)methyl]-1-methyltriazol-4-yl]methanol.
| Compound Name | [5-[(2,4-dichlorophenoxy)methyl]-1-methyltriazol-4-yl]methanol |
|---|---|
| PubChem CID | 82207746 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | [5-[(2,4-dichlorophenoxy)methyl]-1-methyltriazol-4-yl]methanol |
| SMILES | Cn1nnc(CO)c1COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O2/c1-16-10(9(5-17)14-15-16)6-18-11-3-2-7(12)4-8(11)13/h2-4,17H,5-6H2,1H3 |
| InChIKey | FYMDJMWEXJRRMB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |