C19H18N4 — CID 82208924
5-(4-methylphenyl)-1-(3-phenylpropyl)triazole-4-carbonitrile (PubChem CID 82208924) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 5-(4-methylphenyl)-1-(3-phenylpropyl)triazole-4-carbonitrile.
| Compound Name | 5-(4-methylphenyl)-1-(3-phenylpropyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 82208924 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-(4-methylphenyl)-1-(3-phenylpropyl)triazole-4-carbonitrile |
| SMILES | Cc1ccc(-c2c(C#N)nnn2CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4/c1-15-9-11-17(12-10-15)19-18(14-20)21-22-23(19)13-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-12H,5,8,13H2,1H3 |
| InChIKey | XOCMCKNZKGBFCP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |