About 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine
5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine (PubChem CID 822103) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine.
Molecular Properties
| Compound Name | 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine |
| PubChem CID | 822103 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)OCCO2)cc1 |
| InChI | InChI=1S/C18H18O4/c1-19-15-7-3-13(4-8-15)17-18(22-12-11-21-17)14-5-9-16(20-2)10-6-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | KGFOYUSSSCIXOP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine?
The IUPAC name of 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine (CID 822103) is 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine.
What is the SMILES notation for 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine?
The canonical SMILES for 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine is COc1ccc(C2=C(c3ccc(OC)cc3)OCCO2)cc1.
What is the InChIKey of 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine?
The InChIKey is KGFOYUSSSCIXOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c1-19-15-7-3-13(4-8-15)17-18(22-12-11-21-17)14-5-9-16(20-2)10-6-14/h3-10H,11-12H2,1-2H3.
What are the key properties of 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine?
5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine has a molecular weight of 298.34 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(4-methoxyphenyl)-2,3-dihydro-1,4-dioxine is sourced from PubChem (CID 822103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).