C14H15N5O — CID 82210552
4-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]triazol-4-yl]aniline (PubChem CID 82210552) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]triazol-4-yl]aniline.
| Compound Name | 4-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]triazol-4-yl]aniline |
|---|---|
| PubChem CID | 82210552 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]triazol-4-yl]aniline |
| SMILES | Cc1noc(C)c1Cn1nncc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C14H15N5O/c1-9-13(10(2)20-17-9)8-19-14(7-16-18-19)11-3-5-12(15)6-4-11/h3-7H,8,15H2,1-2H3 |
| InChIKey | RIVIKRAVCCRBCI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|