C21H24O4 — CID 822107
1,3-bis(4-methoxy-2,6-dimethylphenyl)propane-1,3-dione (PubChem CID 822107) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1,3-bis(4-methoxy-2,6-dimethylphenyl)propane-1,3-dione.
| Compound Name | 1,3-bis(4-methoxy-2,6-dimethylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 822107 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1,3-bis(4-methoxy-2,6-dimethylphenyl)propane-1,3-dione |
| SMILES | COc1cc(C)c(C(=O)CC(=O)c2c(C)cc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H24O4/c1-12-7-16(24-5)8-13(2)20(12)18(22)11-19(23)21-14(3)9-17(25-6)10-15(21)4/h7-10H,11H2,1-6H3 |
| InChIKey | FSTUGIAOYRQVER-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|