C16H19N3O3 — CID 82212683
5-amino-1-cyclopropyl-N-(2-hydroxypropyl)-4-oxoquinoline-3-carboxamide (PubChem CID 82212683) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-amino-1-cyclopropyl-N-(2-hydroxypropyl)-4-oxoquinoline-3-carboxamide.
| Compound Name | 5-amino-1-cyclopropyl-N-(2-hydroxypropyl)-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 82212683 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 5-amino-1-cyclopropyl-N-(2-hydroxypropyl)-4-oxoquinoline-3-carboxamide |
| SMILES | CC(O)CNC(=O)c1cn(C2CC2)c2cccc(N)c2c1=O |
| InChI | InChI=1S/C16H19N3O3/c1-9(20)7-18-16(22)11-8-19(10-5-6-10)13-4-2-3-12(17)14(13)15(11)21/h2-4,8-10,20H,5-7,17H2,1H3,(H,18,22) |
| InChIKey | RJSZMTOBYGMKLU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|