C12H10ClN3O4 — CID 82212970
8-chloro-1-(2-hydrazinyl-2-oxoethyl)-2-oxoquinoline-6-carboxylic acid (PubChem CID 82212970) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 8-chloro-1-(2-hydrazinyl-2-oxoethyl)-2-oxoquinoline-6-carboxylic acid.
| Compound Name | 8-chloro-1-(2-hydrazinyl-2-oxoethyl)-2-oxoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 82212970 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 8-chloro-1-(2-hydrazinyl-2-oxoethyl)-2-oxoquinoline-6-carboxylic acid |
| SMILES | NNC(=O)Cn1c(=O)ccc2cc(C(=O)O)cc(Cl)c21 |
| InChI | InChI=1S/C12H10ClN3O4/c13-8-4-7(12(19)20)3-6-1-2-10(18)16(11(6)8)5-9(17)15-14/h1-4H,5,14H2,(H,15,17)(H,19,20) |
| InChIKey | LVXLMWARNCNCCY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|