C9H6N2O4 — CID 822133
5-(4-nitrophenyl)-3H-1,3-oxazol-2-one (PubChem CID 822133) has the molecular formula C9H6N2O4 and a molecular weight of 206.16 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-3H-1,3-oxazol-2-one.
| Compound Name | 5-(4-nitrophenyl)-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 822133 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 5-(4-nitrophenyl)-3H-1,3-oxazol-2-one |
| SMILES | O=c1[nH]cc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C9H6N2O4/c12-9-10-5-8(15-9)6-1-3-7(4-2-6)11(13)14/h1-5H,(H,10,12) |
| InChIKey | SEHUDHVEXGRFKF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|