C13H18N2O2S2 — CID 82213685
3-butylsulfanyl-6,8-dimethyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 82213685) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-butylsulfanyl-6,8-dimethyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-butylsulfanyl-6,8-dimethyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 82213685 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-butylsulfanyl-6,8-dimethyl-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCCCSC1=NS(=O)(=O)c2c(C)cc(C)cc2N1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-4-5-6-18-13-14-11-8-9(2)7-10(3)12(11)19(16,17)15-13/h7-8H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | YIVOAHDNRORZJO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|