C9H15N9O3 — CID 82213876
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[2-hydroxyethyl(methyl)amino]methyl]triazole-4-carbohydrazide (PubChem CID 82213876) has the molecular formula C9H15N9O3 and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[2-hydroxyethyl(methyl)amino]methyl]triazole-4-carbohydrazide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[2-hydroxyethyl(methyl)amino]methyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 82213876 |
| Molecular Formula | C9H15N9O3 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[2-hydroxyethyl(methyl)amino]methyl]triazole-4-carbohydrazide |
| SMILES | CN(CCO)Cc1c(C(=O)NN)nnn1-c1nonc1N |
| InChI | InChI=1S/C9H15N9O3/c1-17(2-3-19)4-5-6(9(20)12-11)13-16-18(5)8-7(10)14-21-15-8/h19H,2-4,11H2,1H3,(H2,10,14)(H,12,20) |
| InChIKey | IXDVFMUGOKCQQY-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 174.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|