C17H26ClNO — CID 82214719
1-[2-chloro-2-(2-methoxy-5-methylphenyl)ethyl]-2-ethylpiperidine (PubChem CID 82214719) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is 1-[2-chloro-2-(2-methoxy-5-methylphenyl)ethyl]-2-ethylpiperidine.
| Compound Name | 1-[2-chloro-2-(2-methoxy-5-methylphenyl)ethyl]-2-ethylpiperidine |
|---|---|
| PubChem CID | 82214719 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-[2-chloro-2-(2-methoxy-5-methylphenyl)ethyl]-2-ethylpiperidine |
| SMILES | CCC1CCCCN1CC(Cl)c1cc(C)ccc1OC |
| InChI | InChI=1S/C17H26ClNO/c1-4-14-7-5-6-10-19(14)12-16(18)15-11-13(2)8-9-17(15)20-3/h8-9,11,14,16H,4-7,10,12H2,1-3H3 |
| InChIKey | QJILXGCUMHPPRC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|