C12H20ClNO3 — CID 82215232
2-chloro-2-(furan-2-yl)-N,N-bis(2-methoxyethyl)ethanamine (PubChem CID 82215232) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-chloro-2-(furan-2-yl)-N,N-bis(2-methoxyethyl)ethanamine.
| Compound Name | 2-chloro-2-(furan-2-yl)-N,N-bis(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 82215232 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-chloro-2-(furan-2-yl)-N,N-bis(2-methoxyethyl)ethanamine |
| SMILES | COCCN(CCOC)CC(Cl)c1ccco1 |
| InChI | InChI=1S/C12H20ClNO3/c1-15-8-5-14(6-9-16-2)10-11(13)12-4-3-7-17-12/h3-4,7,11H,5-6,8-10H2,1-2H3 |
| InChIKey | XULMXGYHPDFPIZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|