C14H18FNO3 — CID 82216732
1-[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]pyrrolidine-2-carboxylic acid (PubChem CID 82216732) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 1-[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 82216732 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-[2-(4-fluoro-3-methylphenyl)-2-hydroxyethyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cc(C(O)CN2CCCC2C(=O)O)ccc1F |
| InChI | InChI=1S/C14H18FNO3/c1-9-7-10(4-5-11(9)15)13(17)8-16-6-2-3-12(16)14(18)19/h4-5,7,12-13,17H,2-3,6,8H2,1H3,(H,18,19) |
| InChIKey | LPRIMJXFVQYPFF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |