C15H25NO4 — CID 82216742
2-[bis(2-hydroxyethyl)amino]-1-(2-ethoxy-5-methylphenyl)ethanol (PubChem CID 82216742) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-1-(2-ethoxy-5-methylphenyl)ethanol.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-1-(2-ethoxy-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 82216742 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-1-(2-ethoxy-5-methylphenyl)ethanol |
| SMILES | CCOc1ccc(C)cc1C(O)CN(CCO)CCO |
| InChI | InChI=1S/C15H25NO4/c1-3-20-15-5-4-12(2)10-13(15)14(19)11-16(6-8-17)7-9-18/h4-5,10,14,17-19H,3,6-9,11H2,1-2H3 |
| InChIKey | IGNCGEMHXMNTCV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |