About 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione
6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 822181) has the molecular formula C7H6N4O2
and a molecular weight of 178.15 g/mol. Its IUPAC name is 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| PubChem CID | 822181 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Nc1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C7H6N4O2/c8-3-1-4-5(9-2-3)10-7(13)11-6(4)12/h1-2H,8H2,(H2,9,10,11,12,13) |
| InChIKey | FQFUPPJKZAFGSY-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione?
The IUPAC name of 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione (CID 822181) is 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione?
The canonical SMILES for 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione is Nc1cnc2[nH]c(=O)[nH]c(=O)c2c1.
What is the InChIKey of 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione?
The InChIKey is FQFUPPJKZAFGSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c8-3-1-4-5(9-2-3)10-7(13)11-6(4)12/h1-2H,8H2,(H2,9,10,11,12,13).
What are the key properties of 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione?
6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione has a molecular weight of 178.15 g/mol, XLogP of -0.81, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1H-pyrido[2,3-d]pyrimidine-2,4-dione is sourced from PubChem (CID 822181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).