C14H22N2O5 — CID 82218798
3-[[5-hydroxy-1-(1-hydroxybutan-2-yl)-4-oxo-2-pyridinyl]methyl-methylamino]propanoic acid (PubChem CID 82218798) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[[5-hydroxy-1-(1-hydroxybutan-2-yl)-4-oxo-2-pyridinyl]methyl-methylamino]propanoic acid.
| Compound Name | 3-[[5-hydroxy-1-(1-hydroxybutan-2-yl)-4-oxo-2-pyridinyl]methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 82218798 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-[[5-hydroxy-1-(1-hydroxybutan-2-yl)-4-oxo-2-pyridinyl]methyl-methylamino]propanoic acid |
| SMILES | CCC(CO)n1cc(O)c(=O)cc1CN(C)CCC(=O)O |
| InChI | InChI=1S/C14H22N2O5/c1-3-10(9-17)16-8-13(19)12(18)6-11(16)7-15(2)5-4-14(20)21/h6,8,10,17,19H,3-5,7,9H2,1-2H3,(H,20,21) |
| InChIKey | PFIHNIVLFVKGHQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |