C16H24N2O5 — CID 82218843
3-hydroxy-2-[5-hydroxy-2-[(3-methylpiperidin-1-yl)methyl]-4-oxo-1-pyridinyl]butanoic acid (PubChem CID 82218843) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-hydroxy-2-[5-hydroxy-2-[(3-methylpiperidin-1-yl)methyl]-4-oxo-1-pyridinyl]butanoic acid.
| Compound Name | 3-hydroxy-2-[5-hydroxy-2-[(3-methylpiperidin-1-yl)methyl]-4-oxo-1-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 82218843 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-hydroxy-2-[5-hydroxy-2-[(3-methylpiperidin-1-yl)methyl]-4-oxo-1-pyridinyl]butanoic acid |
| SMILES | CC1CCCN(Cc2cc(=O)c(O)cn2C(C(=O)O)C(C)O)C1 |
| InChI | InChI=1S/C16H24N2O5/c1-10-4-3-5-17(7-10)8-12-6-13(20)14(21)9-18(12)15(11(2)19)16(22)23/h6,9-11,15,19,21H,3-5,7-8H2,1-2H3,(H,22,23) |
| InChIKey | KGGWPXAJVRTSHL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |