C7H3Cl3N4S — CID 82219292
6-methyl-2-(trichloromethyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbonitrile (PubChem CID 82219292) has the molecular formula C7H3Cl3N4S and a molecular weight of 281.56 g/mol. Its IUPAC name is 6-methyl-2-(trichloromethyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbonitrile.
| Compound Name | 6-methyl-2-(trichloromethyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82219292 |
| Molecular Formula | C7H3Cl3N4S |
| Molecular Weight | 281.56 g/mol |
| Exact Mass | 279.91 |
| IUPAC Name | 6-methyl-2-(trichloromethyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbonitrile |
| SMILES | Cc1nc2sc(C(Cl)(Cl)Cl)nn2c1C#N |
| InChI | InChI=1S/C7H3Cl3N4S/c1-3-4(2-11)14-6(12-3)15-5(13-14)7(8,9)10/h1H3 |
| InChIKey | NAINPJBUZWNJLT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|