C9H10N4O2 — CID 822193
1,6,7-trimethylpteridine-2,4-dione (PubChem CID 822193) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 1,6,7-trimethylpteridine-2,4-dione.
| Compound Name | 1,6,7-trimethylpteridine-2,4-dione |
|---|---|
| PubChem CID | 822193 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1,6,7-trimethylpteridine-2,4-dione |
| SMILES | Cc1nc2c(=O)[nH]c(=O)n(C)c2nc1C |
| InChI | InChI=1S/C9H10N4O2/c1-4-5(2)11-7-6(10-4)8(14)12-9(15)13(7)3/h1-3H3,(H,12,14,15) |
| InChIKey | XCOSZAUDQCILGD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |