C16H18N2O2S — CID 82220047
6-methyl-4-(4-methylphenyl)-2-prop-2-enylsulfanyl-1,4-dihydropyrimidine-5-carboxylic acid (PubChem CID 82220047) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 6-methyl-4-(4-methylphenyl)-2-prop-2-enylsulfanyl-1,4-dihydropyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-4-(4-methylphenyl)-2-prop-2-enylsulfanyl-1,4-dihydropyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 82220047 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 6-methyl-4-(4-methylphenyl)-2-prop-2-enylsulfanyl-1,4-dihydropyrimidine-5-carboxylic acid |
| SMILES | C=CCSC1=NC(c2ccc(C)cc2)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C16H18N2O2S/c1-4-9-21-16-17-11(3)13(15(19)20)14(18-16)12-7-5-10(2)6-8-12/h4-8,14H,1,9H2,2-3H3,(H,17,18)(H,19,20) |
| InChIKey | DXMHIJKYVZVSIJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|