C14H15N3O3S — CID 82220561
4-(5,6,7-trimethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine (PubChem CID 82220561) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4-(5,6,7-trimethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(5,6,7-trimethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82220561 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-(5,6,7-trimethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine |
| SMILES | COc1cc2c(-c3csc(N)n3)c[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C14H15N3O3S/c1-18-10-4-7-8(9-6-21-14(15)17-9)5-16-11(7)13(20-3)12(10)19-2/h4-6,16H,1-3H3,(H2,15,17) |
| InChIKey | TWVPCHFMLWARKJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |