5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid

C12H14N4O2S — CID 82220736

IUPAC5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid
SMILESO=C(O)c1nnn(-c2nccs2)c1C1CCCCC1
InChIInChI=1S/C12H14N4O2S/c17-11(18)9-10(8-4-2-1-3-5-8)16(15-14-9)12-13-6-7-19-12/h6-8H,1-5H2,(H,17,18)
InChIKeyRTPRFNFPFARAGI-UHFFFAOYSA-N
MW278.34 g/mol
LogP2.47
Rot. Bonds3

About 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid

5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid (PubChem CID 82220736) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid.

Molecular Properties

Compound Name5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid
PubChem CID82220736
Molecular FormulaC12H14N4O2S
Molecular Weight278.34 g/mol
Exact Mass278.08
IUPAC Name5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid
SMILESO=C(O)c1nnn(-c2nccs2)c1C1CCCCC1
InChIInChI=1S/C12H14N4O2S/c17-11(18)9-10(8-4-2-1-3-5-8)16(15-14-9)12-13-6-7-19-12/h6-8H,1-5H2,(H,17,18)
InChIKeyRTPRFNFPFARAGI-UHFFFAOYSA-N
XLogP2.47
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.34
LogP ≤ 52.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid?
The IUPAC name of 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid (CID 82220736) is 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid.
What is the SMILES notation for 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid?
The canonical SMILES for 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid is O=C(O)c1nnn(-c2nccs2)c1C1CCCCC1.
What is the InChIKey of 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid?
The InChIKey is RTPRFNFPFARAGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S/c17-11(18)9-10(8-4-2-1-3-5-8)16(15-14-9)12-13-6-7-19-12/h6-8H,1-5H2,(H,17,18).
What are the key properties of 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid?
5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid has a molecular weight of 278.34 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-1-(1,3-thiazol-2-yl)triazole-4-carboxylic acid is sourced from PubChem (CID 82220736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).