About propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate
propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate (PubChem CID 82220971) has the molecular formula C9H11N5O2S
and a molecular weight of 253.29 g/mol. Its IUPAC name is propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate |
| PubChem CID | 82220971 |
| Molecular Formula | C9H11N5O2S |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate |
| SMILES | CC(C)OC(=O)c1nnn(-c2nccs2)c1N |
| InChI | InChI=1S/C9H11N5O2S/c1-5(2)16-8(15)6-7(10)14(13-12-6)9-11-3-4-17-9/h3-5H,10H2,1-2H3 |
| InChIKey | SHHYIFPXKWFSCU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate?
The IUPAC name of propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate (CID 82220971) is propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate.
What is the SMILES notation for propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate?
The canonical SMILES for propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate is CC(C)OC(=O)c1nnn(-c2nccs2)c1N.
What is the InChIKey of propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate?
The InChIKey is SHHYIFPXKWFSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O2S/c1-5(2)16-8(15)6-7(10)14(13-12-6)9-11-3-4-17-9/h3-5H,10H2,1-2H3.
What are the key properties of propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate?
propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate has a molecular weight of 253.29 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 5-amino-1-(1,3-thiazol-2-yl)triazole-4-carboxylate is sourced from PubChem (CID 82220971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).