About 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile
5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile (PubChem CID 82221269) has the molecular formula C10H12N6S
and a molecular weight of 248.31 g/mol. Its IUPAC name is 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile |
| PubChem CID | 82221269 |
| Molecular Formula | C10H12N6S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile |
| SMILES | CCCCc1c(C#N)nnn1-c1nnc(C)s1 |
| InChI | InChI=1S/C10H12N6S/c1-3-4-5-9-8(6-11)13-15-16(9)10-14-12-7(2)17-10/h3-5H2,1-2H3 |
| InChIKey | NJOFAGUVWZWZPL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile?
The IUPAC name of 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile (CID 82221269) is 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile.
What is the SMILES notation for 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile?
The canonical SMILES for 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile is CCCCc1c(C#N)nnn1-c1nnc(C)s1.
What is the InChIKey of 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile?
The InChIKey is NJOFAGUVWZWZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6S/c1-3-4-5-9-8(6-11)13-15-16(9)10-14-12-7(2)17-10/h3-5H2,1-2H3.
What are the key properties of 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile?
5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile has a molecular weight of 248.31 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-1-(5-methyl-1,3,4-thiadiazol-2-yl)triazole-4-carbonitrile is sourced from PubChem (CID 82221269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).