C13H13N3O4 — CID 82222512
4-[5-(2-ethoxy-2-oxoethyl)triazol-1-yl]benzoic acid (PubChem CID 82222512) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 4-[5-(2-ethoxy-2-oxoethyl)triazol-1-yl]benzoic acid.
| Compound Name | 4-[5-(2-ethoxy-2-oxoethyl)triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 82222512 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-[5-(2-ethoxy-2-oxoethyl)triazol-1-yl]benzoic acid |
| SMILES | CCOC(=O)Cc1cnnn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H13N3O4/c1-2-20-12(17)7-11-8-14-15-16(11)10-5-3-9(4-6-10)13(18)19/h3-6,8H,2,7H2,1H3,(H,18,19) |
| InChIKey | AGEGYICDBJOIEN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |