2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid

C10H7F2N3O2 — CID 82222591

IUPAC2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid
SMILESO=C(O)Cn1nncc1-c1ccc(F)c(F)c1
InChIInChI=1S/C10H7F2N3O2/c11-7-2-1-6(3-8(7)12)9-4-13-14-15(9)5-10(16)17/h1-4H,5H2,(H,16,17)
InChIKeyVAFWZTMYNCNTBM-UHFFFAOYSA-N
MW239.18 g/mol
LogP1.31
Rot. Bonds3

About 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid

2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid (PubChem CID 82222591) has the molecular formula C10H7F2N3O2 and a molecular weight of 239.18 g/mol. Its IUPAC name is 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid
PubChem CID82222591
Molecular FormulaC10H7F2N3O2
Molecular Weight239.18 g/mol
Exact Mass239.05
IUPAC Name2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid
SMILESO=C(O)Cn1nncc1-c1ccc(F)c(F)c1
InChIInChI=1S/C10H7F2N3O2/c11-7-2-1-6(3-8(7)12)9-4-13-14-15(9)5-10(16)17/h1-4H,5H2,(H,16,17)
InChIKeyVAFWZTMYNCNTBM-UHFFFAOYSA-N
XLogP1.31
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.18
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid?
The IUPAC name of 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid (CID 82222591) is 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid.
What is the SMILES notation for 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid?
The canonical SMILES for 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid is O=C(O)Cn1nncc1-c1ccc(F)c(F)c1.
What is the InChIKey of 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid?
The InChIKey is VAFWZTMYNCNTBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2N3O2/c11-7-2-1-6(3-8(7)12)9-4-13-14-15(9)5-10(16)17/h1-4H,5H2,(H,16,17).
What are the key properties of 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid?
2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid has a molecular weight of 239.18 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,4-difluorophenyl)triazol-1-yl]acetic acid is sourced from PubChem (CID 82222591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).