C13H19N3O3 — CID 82224712
3-[[1-(3-aminoanilino)-1-oxopropan-2-yl]-methylamino]propanoic acid (PubChem CID 82224712) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[[1-(3-aminoanilino)-1-oxopropan-2-yl]-methylamino]propanoic acid.
| Compound Name | 3-[[1-(3-aminoanilino)-1-oxopropan-2-yl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 82224712 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-[[1-(3-aminoanilino)-1-oxopropan-2-yl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)Nc1cccc(N)c1)N(C)CCC(=O)O |
| InChI | InChI=1S/C13H19N3O3/c1-9(16(2)7-6-12(17)18)13(19)15-11-5-3-4-10(14)8-11/h3-5,8-9H,6-7,14H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | LSYFNXZKCZUMFO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|