About 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid
2-amino-4-propyl-1,3-thiazole-5-carboxylic acid (PubChem CID 82225421) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 82225421 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCc1nc(N)sc1C(=O)O |
| InChI | InChI=1S/C7H10N2O2S/c1-2-3-4-5(6(10)11)12-7(8)9-4/h2-3H2,1H3,(H2,8,9)(H,10,11) |
| InChIKey | GXDBIGZRURDVLC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid (CID 82225421) is 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid is CCCc1nc(N)sc1C(=O)O.
What is the InChIKey of 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is GXDBIGZRURDVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-2-3-4-5(6(10)11)12-7(8)9-4/h2-3H2,1H3,(H2,8,9)(H,10,11).
What are the key properties of 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid?
2-amino-4-propyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 186.24 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-propyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 82225421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).