C13H15FN4O2 — CID 82226046
2-[5-[(4-fluorophenyl)methyl]tetrazol-1-yl]pentanoic acid (PubChem CID 82226046) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[5-[(4-fluorophenyl)methyl]tetrazol-1-yl]pentanoic acid.
| Compound Name | 2-[5-[(4-fluorophenyl)methyl]tetrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 82226046 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[5-[(4-fluorophenyl)methyl]tetrazol-1-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)n1nnnc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN4O2/c1-2-3-11(13(19)20)18-12(15-16-17-18)8-9-4-6-10(14)7-5-9/h4-7,11H,2-3,8H2,1H3,(H,19,20) |
| InChIKey | VAEGBFVEKGTRJT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |