C12H14N2O5S — CID 82226521
2-[[(E)-3-carboxyprop-2-enoyl]amino]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82226521) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[[(E)-3-carboxyprop-2-enoyl]amino]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[(E)-3-carboxyprop-2-enoyl]amino]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82226521 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-[[(E)-3-carboxyprop-2-enoyl]amino]-4-(2-methylpropyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(C)Cc1nc(NC(=O)/C=C/C(=O)O)sc1C(=O)O |
| InChI | InChI=1S/C12H14N2O5S/c1-6(2)5-7-10(11(18)19)20-12(13-7)14-8(15)3-4-9(16)17/h3-4,6H,5H2,1-2H3,(H,16,17)(H,18,19)(H,13,14,15)/b4-3+ |
| InChIKey | CXNRPFAHDRQDEZ-ONEGZZNKSA-N |
| XLogP | 1.62 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|