2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid

C13H13NO3S — CID 82226862

IUPAC2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(-c2ccc(OC)cc2)c(C(=O)O)s1
InChIInChI=1S/C13H13NO3S/c1-3-10-14-11(12(18-10)13(15)16)8-4-6-9(17-2)7-5-8/h4-7H,3H2,1-2H3,(H,15,16)
InChIKeyZZNLLEZOJPAKHJ-UHFFFAOYSA-N
MW263.32 g/mol
LogP3.08
Rot. Bonds4

About 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid

2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82226862) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid
PubChem CID82226862
Molecular FormulaC13H13NO3S
Molecular Weight263.32 g/mol
Exact Mass263.06
IUPAC Name2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(-c2ccc(OC)cc2)c(C(=O)O)s1
InChIInChI=1S/C13H13NO3S/c1-3-10-14-11(12(18-10)13(15)16)8-4-6-9(17-2)7-5-8/h4-7H,3H2,1-2H3,(H,15,16)
InChIKeyZZNLLEZOJPAKHJ-UHFFFAOYSA-N
XLogP3.08
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.32
LogP ≤ 53.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid (CID 82226862) is 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid is CCc1nc(-c2ccc(OC)cc2)c(C(=O)O)s1.
What is the InChIKey of 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is ZZNLLEZOJPAKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-3-10-14-11(12(18-10)13(15)16)8-4-6-9(17-2)7-5-8/h4-7H,3H2,1-2H3,(H,15,16).
What are the key properties of 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 263.32 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 82226862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).