About 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid
4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 82227482) has the molecular formula C13H12F2N2O2S
and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 82227482 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CN(C)Cc1nc(-c2ccc(F)c(F)c2)c(C(=O)O)s1 |
| InChI | InChI=1S/C13H12F2N2O2S/c1-17(2)6-10-16-11(12(20-10)13(18)19)7-3-4-8(14)9(15)5-7/h3-5H,6H2,1-2H3,(H,18,19) |
| InChIKey | VCJHMYLWMNVEBT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid (CID 82227482) is 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid is CN(C)Cc1nc(-c2ccc(F)c(F)c2)c(C(=O)O)s1.
What is the InChIKey of 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is VCJHMYLWMNVEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2O2S/c1-17(2)6-10-16-11(12(20-10)13(18)19)7-3-4-8(14)9(15)5-7/h3-5H,6H2,1-2H3,(H,18,19).
What are the key properties of 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid?
4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 298.31 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-2-[(dimethylamino)methyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 82227482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).